C19H22O2S2 — CID 13425755
(4R,5R)-2,2-dimethyl-4,5-bis(phenylsulfanylmethyl)-1,3-dioxolane (PubChem CID 13425755) has the molecular formula C19H22O2S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-bis(phenylsulfanylmethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-bis(phenylsulfanylmethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13425755 |
| Molecular Formula | C19H22O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-bis(phenylsulfanylmethyl)-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](CSc2ccccc2)[C@H](CSc2ccccc2)O1 |
| InChI | InChI=1S/C19H22O2S2/c1-19(2)20-17(13-22-15-9-5-3-6-10-15)18(21-19)14-23-16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | SWEFQFNDVYVHCD-ROUUACIJSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |