C21H24O3S2 — CID 56589854
(4R,5R)-5-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 56589854) has the molecular formula C21H24O3S2 and a molecular weight of 388.55 g/mol. Its IUPAC name is (4R,5R)-5-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5R)-5-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 56589854 |
| Molecular Formula | C21H24O3S2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (4R,5R)-5-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@H]2C=O)cc1 |
| InChI | InChI=1S/C21H24O3S2/c1-14-5-9-16(10-6-14)25-20(26-17-11-7-15(2)8-12-17)19-18(13-22)23-21(3,4)24-19/h5-13,18-20H,1-4H3/t18-,19+/m0/s1 |
| InChIKey | FZHZFLJBAHKEHW-RBUKOAKNSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|