C23H34F3NO5 — CID 144642435
tert-butyl (2R)-2-benzyl-4-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate;1,1,1-trifluoro-3,3-dimethoxypropane (PubChem CID 144642435) has the molecular formula C23H34F3NO5 and a molecular weight of 461.52 g/mol. Its IUPAC name is tert-butyl (2R)-2-benzyl-4-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate;1,1,1-trifluoro-3,3-dimethoxypropane.
| Compound Name | tert-butyl (2R)-2-benzyl-4-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate;1,1,1-trifluoro-3,3-dimethoxypropane |
|---|---|
| PubChem CID | 144642435 |
| Molecular Formula | C23H34F3NO5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | tert-butyl (2R)-2-benzyl-4-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate;1,1,1-trifluoro-3,3-dimethoxypropane |
| SMILES | COC(CC(F)(F)F)OC.COC1=CCN(C(=O)OC(C)(C)C)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H25NO3.C5H9F3O2/c1-18(2,3)22-17(20)19-11-10-16(21-4)13-15(19)12-14-8-6-5-7-9-14;1-9-4(10-2)3-5(6,7)8/h5-10,15H,11-13H2,1-4H3;4H,3H2,1-2H3/t15-;/m1./s1 |
| InChIKey | VHZJZLDDRGPAAP-XFULWGLBSA-N |
| XLogP | 5.33 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|