C21H35NO4 — CID 11003042
tert-butyl N-benzyl-N-[(3S)-6,6-dimethoxy-2-methylhexan-3-yl]carbamate (PubChem CID 11003042) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S)-6,6-dimethoxy-2-methylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S)-6,6-dimethoxy-2-methylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 11003042 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S)-6,6-dimethoxy-2-methylhexan-3-yl]carbamate |
| SMILES | COC(CC[C@@H](C(C)C)N(Cc1ccccc1)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C21H35NO4/c1-16(2)18(13-14-19(24-6)25-7)22(20(23)26-21(3,4)5)15-17-11-9-8-10-12-17/h8-12,16,18-19H,13-15H2,1-7H3/t18-/m0/s1 |
| InChIKey | CDFSMJHAXHJKKV-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|