C25H37NO4 — CID 10971749
tert-butyl N-benzyl-N-[(3S)-3-[1-(1,3-dioxan-2-yl)propyl]hex-5-ynyl]carbamate (PubChem CID 10971749) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S)-3-[1-(1,3-dioxan-2-yl)propyl]hex-5-ynyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S)-3-[1-(1,3-dioxan-2-yl)propyl]hex-5-ynyl]carbamate |
|---|---|
| PubChem CID | 10971749 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S)-3-[1-(1,3-dioxan-2-yl)propyl]hex-5-ynyl]carbamate |
| SMILES | C#CC[C@@H](CCN(Cc1ccccc1)C(=O)OC(C)(C)C)C(CC)C1OCCCO1 |
| InChI | InChI=1S/C25H37NO4/c1-6-12-21(22(7-2)23-28-17-11-18-29-23)15-16-26(24(27)30-25(3,4)5)19-20-13-9-8-10-14-20/h1,8-10,13-14,21-23H,7,11-12,15-19H2,2-5H3/t21-,22?/m0/s1 |
| InChIKey | QSIRXRHWRIAMJD-HMTLIYDFSA-N |
| XLogP | 5.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|