C23H33NO4 — CID 10905176
methyl (3S)-3-[2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-2-ethylhex-5-ynoate (PubChem CID 10905176) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is methyl (3S)-3-[2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-2-ethylhex-5-ynoate.
| Compound Name | methyl (3S)-3-[2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-2-ethylhex-5-ynoate |
|---|---|
| PubChem CID | 10905176 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | methyl (3S)-3-[2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-2-ethylhex-5-ynoate |
| SMILES | C#CC[C@@H](CCN(Cc1ccccc1)C(=O)OC(C)(C)C)C(CC)C(=O)OC |
| InChI | InChI=1S/C23H33NO4/c1-7-12-19(20(8-2)21(25)27-6)15-16-24(22(26)28-23(3,4)5)17-18-13-10-9-11-14-18/h1,9-11,13-14,19-20H,8,12,15-17H2,2-6H3/t19-,20?/m0/s1 |
| InChIKey | TWOSBZFZXZHCQC-XJDOXCRVSA-N |
| XLogP | 4.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|