C30H43NO3 — CID 11454089
(3S,4R,5E)-N,N-dibenzyl-4-[2-(2-methoxyethoxymethoxy)ethyl]-2,6-dimethylocta-5,7-dien-3-amine (PubChem CID 11454089) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol. Its IUPAC name is (3S,4R,5E)-N,N-dibenzyl-4-[2-(2-methoxyethoxymethoxy)ethyl]-2,6-dimethylocta-5,7-dien-3-amine.
| Compound Name | (3S,4R,5E)-N,N-dibenzyl-4-[2-(2-methoxyethoxymethoxy)ethyl]-2,6-dimethylocta-5,7-dien-3-amine |
|---|---|
| PubChem CID | 11454089 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | (3S,4R,5E)-N,N-dibenzyl-4-[2-(2-methoxyethoxymethoxy)ethyl]-2,6-dimethylocta-5,7-dien-3-amine |
| SMILES | C=C/C(C)=C/[C@@H](CCOCOCCOC)[C@H](C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H43NO3/c1-6-26(4)21-29(17-18-33-24-34-20-19-32-5)30(25(2)3)31(22-27-13-9-7-10-14-27)23-28-15-11-8-12-16-28/h6-16,21,25,29-30H,1,17-20,22-24H2,2-5H3/b26-21+/t29-,30+/m1/s1 |
| InChIKey | PERDAOPILDCFHT-GKRCIHQMSA-N |
| XLogP | 6.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|