C40H28N6 — CID 144644893
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methanimidoyl-N-phenylcarbazol-2-amine (PubChem CID 144644893) has the molecular formula C40H28N6 and a molecular weight of 592.71 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methanimidoyl-N-phenylcarbazol-2-amine.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methanimidoyl-N-phenylcarbazol-2-amine |
|---|---|
| PubChem CID | 144644893 |
| Molecular Formula | C40H28N6 |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methanimidoyl-N-phenylcarbazol-2-amine |
| SMILES | [H]/N=C/c1cc2c3ccccc3n(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2cc1Nc1ccccc1 |
| InChI | InChI=1S/C40H28N6/c41-26-30-24-34-33-21-10-11-22-36(33)46(37(34)25-35(30)42-31-18-8-3-9-19-31)32-20-12-17-29(23-32)40-44-38(27-13-4-1-5-14-27)43-39(45-40)28-15-6-2-7-16-28/h1-26,41-42H/b41-26+ |
| InChIKey | XUVIGQYIGFTSLS-MMFILIDRSA-N |
| XLogP | 9.71 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|