C58H39N7 — CID 145340516
N-[9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]carbazol-1-yl]-1-methanimidoyl-9-phenylcarbazol-2-amine (PubChem CID 145340516) has the molecular formula C58H39N7 and a molecular weight of 834.00 g/mol. Its IUPAC name is N-[9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]carbazol-1-yl]-1-methanimidoyl-9-phenylcarbazol-2-amine.
| Compound Name | N-[9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]carbazol-1-yl]-1-methanimidoyl-9-phenylcarbazol-2-amine |
|---|---|
| PubChem CID | 145340516 |
| Molecular Formula | C58H39N7 |
| Molecular Weight | 834.00 g/mol |
| Exact Mass | 833.33 |
| IUPAC Name | N-[9-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]carbazol-1-yl]-1-methanimidoyl-9-phenylcarbazol-2-amine |
| SMILES | [H]/N=C/c1c(Nc2cccc3c4ccccc4n(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)c23)ccc2c3ccccc3n(-c3ccccc3)c12 |
| InChI | InChI=1S/C58H39N7/c59-37-49-50(34-33-48-46-28-11-12-31-52(46)64(54(48)49)43-24-8-3-9-25-43)60-51-30-16-29-47-45-27-10-13-32-53(45)65(55(47)51)44-26-15-22-41(36-44)40-21-14-23-42(35-40)58-62-56(38-17-4-1-5-18-38)61-57(63-58)39-19-6-2-7-20-39/h1-37,59-60H/b59-37+ |
| InChIKey | SOILYIKESIZRGW-OGTBTPGWSA-N |
| XLogP | 14.48 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.00 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|