C43H38N6 — CID 144645979
6-[4-[[[(Z)-3-aminoprop-2-enylidene]amino]methyl]phenyl]-3-N,1-diphenylpyrrolo[3,2-c]carbazole-2,3-diamine;toluene (PubChem CID 144645979) has the molecular formula C43H38N6 and a molecular weight of 638.82 g/mol. Its IUPAC name is 6-[4-[[[(Z)-3-aminoprop-2-enylidene]amino]methyl]phenyl]-3-N,1-diphenylpyrrolo[3,2-c]carbazole-2,3-diamine;toluene.
| Compound Name | 6-[4-[[[(Z)-3-aminoprop-2-enylidene]amino]methyl]phenyl]-3-N,1-diphenylpyrrolo[3,2-c]carbazole-2,3-diamine;toluene |
|---|---|
| PubChem CID | 144645979 |
| Molecular Formula | C43H38N6 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | 6-[4-[[[(Z)-3-aminoprop-2-enylidene]amino]methyl]phenyl]-3-N,1-diphenylpyrrolo[3,2-c]carbazole-2,3-diamine;toluene |
| SMILES | Cc1ccccc1.N/C=C\C=N\Cc1ccc(-n2c3ccccc3c3c4c(ccc32)c(Nc2ccccc2)c(N)n4-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N6.C7H8/c37-22-9-23-39-24-25-16-18-28(19-17-25)41-31-15-8-7-14-29(31)33-32(41)21-20-30-34(40-26-10-3-1-4-11-26)36(38)42(35(30)33)27-12-5-2-6-13-27;1-7-5-3-2-4-6-7/h1-23,40H,24,37-38H2;2-6H,1H3/b22-9-,39-23+; |
| InChIKey | XKWJNVRRJBIUFF-BGHHDMPOSA-N |
| XLogP | 10.09 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|