C20H22N2 — CID 144646612
(3Z)-4-N-[(4-methylphenyl)methyl]-4-N-phenylhexa-1,3,5-triene-3,4-diamine (PubChem CID 144646612) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (3Z)-4-N-[(4-methylphenyl)methyl]-4-N-phenylhexa-1,3,5-triene-3,4-diamine.
| Compound Name | (3Z)-4-N-[(4-methylphenyl)methyl]-4-N-phenylhexa-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 144646612 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (3Z)-4-N-[(4-methylphenyl)methyl]-4-N-phenylhexa-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(N)=C(\C=C)N(Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2/c1-4-19(21)20(5-2)22(18-9-7-6-8-10-18)15-17-13-11-16(3)12-14-17/h4-14H,1-2,15,21H2,3H3/b20-19- |
| InChIKey | GRMLXGXARHFZEG-VXPUYCOJSA-N |
| XLogP | 4.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|