C17H16N2 — CID 144646695
N'-naphthalen-1-yl-N'-phenylmethanediamine (PubChem CID 144646695) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N'-naphthalen-1-yl-N'-phenylmethanediamine.
| Compound Name | N'-naphthalen-1-yl-N'-phenylmethanediamine |
|---|---|
| PubChem CID | 144646695 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N'-naphthalen-1-yl-N'-phenylmethanediamine |
| SMILES | NCN(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H16N2/c18-13-19(15-9-2-1-3-10-15)17-12-6-8-14-7-4-5-11-16(14)17/h1-12H,13,18H2 |
| InChIKey | XPVJMBWJRGCVOL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|