C16H13NS — CID 57319297
N-naphthalen-1-yl-N-phenylthiohydroxylamine (PubChem CID 57319297) has the molecular formula C16H13NS and a molecular weight of 251.35 g/mol. Its IUPAC name is N-naphthalen-1-yl-N-phenylthiohydroxylamine.
| Compound Name | N-naphthalen-1-yl-N-phenylthiohydroxylamine |
|---|---|
| PubChem CID | 57319297 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-naphthalen-1-yl-N-phenylthiohydroxylamine |
| SMILES | SN(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H13NS/c18-17(14-9-2-1-3-10-14)16-12-6-8-13-7-4-5-11-15(13)16/h1-12,18H |
| InChIKey | HSOCRLAZYGHNPT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|