About ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone
ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone (PubChem CID 144649667) has the molecular formula C24H35NO
and a molecular weight of 353.55 g/mol. Its IUPAC name is ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone.
Molecular Properties
| Compound Name | ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone |
| PubChem CID | 144649667 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone |
| SMILES | C=C(C)c1cccc(C(C)=O)n1.CC.CCCc1cccc(CC)c1C |
| InChI | InChI=1S/C12H18.C10H11NO.C2H6/c1-4-7-12-9-6-8-11(5-2)10(12)3;1-7(2)9-5-4-6-10(11-9)8(3)12;1-2/h6,8-9H,4-5,7H2,1-3H3;4-6H,1H2,2-3H3;1-2H3 |
| InChIKey | FQBMIYXQMMUKOF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone?
The IUPAC name of ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone (CID 144649667) is ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone.
What is the SMILES notation for ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone?
The canonical SMILES for ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone is C=C(C)c1cccc(C(C)=O)n1.CC.CCCc1cccc(CC)c1C.
What is the InChIKey of ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone?
The InChIKey is FQBMIYXQMMUKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C10H11NO.C2H6/c1-4-7-12-9-6-8-11(5-2)10(12)3;1-7(2)9-5-4-6-10(11-9)8(3)12;1-2/h6,8-9H,4-5,7H2,1-3H3;4-6H,1H2,2-3H3;1-2H3.
What are the key properties of ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone?
ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone has a molecular weight of 353.55 g/mol, XLogP of 6.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2-methyl-3-propylbenzene;1-(6-prop-1-en-2-yl-2-pyridinyl)ethanone is sourced from PubChem (CID 144649667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).