C52H45NO — CID 144649944
1-[4-[4-[(4E,6Z)-6-(4-dibenzofuran-2-ylphenyl)nona-4,6-dien-4-yl]phenyl]phenyl]-3-ethenyl-2-[(Z)-prop-1-enyl]indole (PubChem CID 144649944) has the molecular formula C52H45NO and a molecular weight of 699.94 g/mol. Its IUPAC name is 1-[4-[4-[(4E,6Z)-6-(4-dibenzofuran-2-ylphenyl)nona-4,6-dien-4-yl]phenyl]phenyl]-3-ethenyl-2-[(Z)-prop-1-enyl]indole.
| Compound Name | 1-[4-[4-[(4E,6Z)-6-(4-dibenzofuran-2-ylphenyl)nona-4,6-dien-4-yl]phenyl]phenyl]-3-ethenyl-2-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 144649944 |
| Molecular Formula | C52H45NO |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.35 |
| IUPAC Name | 1-[4-[4-[(4E,6Z)-6-(4-dibenzofuran-2-ylphenyl)nona-4,6-dien-4-yl]phenyl]phenyl]-3-ethenyl-2-[(Z)-prop-1-enyl]indole |
| SMILES | C=Cc1c(/C=C\C)n(-c2ccc(-c3ccc(/C(=C/C(=C/CC)c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)CCC)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C52H45NO/c1-5-13-41(34-42(14-6-2)39-24-26-40(27-25-39)43-30-33-52-48(35-43)47-17-10-12-19-51(47)54-52)38-22-20-36(21-23-38)37-28-31-44(32-29-37)53-49(15-7-3)45(8-4)46-16-9-11-18-50(46)53/h7-12,14-35H,4-6,13H2,1-3H3/b15-7-,41-34+,42-14- |
| InChIKey | FJTSATXEPIYNSY-DFNGWIBMSA-N |
| XLogP | 15.22 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|