C11H21NO — CID 14465012
(2S,3R)-N-butyl-2,3-dimethylpent-4-enamide (PubChem CID 14465012) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2S,3R)-N-butyl-2,3-dimethylpent-4-enamide.
| Compound Name | (2S,3R)-N-butyl-2,3-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 14465012 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2S,3R)-N-butyl-2,3-dimethylpent-4-enamide |
| SMILES | C=C[C@@H](C)[C@H](C)C(=O)NCCCC |
| InChI | InChI=1S/C11H21NO/c1-5-7-8-12-11(13)10(4)9(3)6-2/h6,9-10H,2,5,7-8H2,1,3-4H3,(H,12,13)/t9-,10+/m1/s1 |
| InChIKey | FSCRMXIFZBLHHZ-ZJUUUORDSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|