C30H19Cl2NO — CID 144650904
(4Z,6Z)-8-[4-(3,5-dichlorophenyl)phenyl]-3-methylidene-19-oxa-8-azatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene (PubChem CID 144650904) has the molecular formula C30H19Cl2NO and a molecular weight of 480.39 g/mol. Its IUPAC name is (4Z,6Z)-8-[4-(3,5-dichlorophenyl)phenyl]-3-methylidene-19-oxa-8-azatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene.
| Compound Name | (4Z,6Z)-8-[4-(3,5-dichlorophenyl)phenyl]-3-methylidene-19-oxa-8-azatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene |
|---|---|
| PubChem CID | 144650904 |
| Molecular Formula | C30H19Cl2NO |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | (4Z,6Z)-8-[4-(3,5-dichlorophenyl)phenyl]-3-methylidene-19-oxa-8-azatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene |
| SMILES | C=C1/C=C\C=C/N(c2ccc(-c3cc(Cl)cc(Cl)c3)cc2)c2ccc3c(oc4ccccc43)c21 |
| InChI | InChI=1S/C30H19Cl2NO/c1-19-6-4-5-15-33(24-11-9-20(10-12-24)21-16-22(31)18-23(32)17-21)27-14-13-26-25-7-2-3-8-28(25)34-30(26)29(19)27/h2-18H,1H2/b6-4-,15-5- |
| InChIKey | BSJVRVLSEPWBJZ-QRRQCYJXSA-N |
| XLogP | 9.79 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |