About [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate
[bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate (PubChem CID 144651116) has the molecular formula C16H26BrGaO4
and a molecular weight of 432.01 g/mol. Its IUPAC name is [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate.
Molecular Properties
| Compound Name | [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate |
| PubChem CID | 144651116 |
| Molecular Formula | C16H26BrGaO4 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate |
| SMILES | O=C(O[Ga](Br)OC(=O)C1CCCCCC1)C1CCCCCC1 |
| InChI | InChI=1S/2C8H14O2.BrH.Ga/c2*9-8(10)7-5-3-1-2-4-6-7;;/h2*7H,1-6H2,(H,9,10);1H;/q;;;+3/p-3 |
| InChIKey | FHWFIYRVUSKEEH-UHFFFAOYSA-K |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate?
The IUPAC name of [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate (CID 144651116) is [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate.
What is the SMILES notation for [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate?
The canonical SMILES for [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate is O=C(O[Ga](Br)OC(=O)C1CCCCCC1)C1CCCCCC1.
What is the InChIKey of [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate?
The InChIKey is FHWFIYRVUSKEEH-UHFFFAOYSA-K. The full InChI is InChI=1S/2C8H14O2.BrH.Ga/c2*9-8(10)7-5-3-1-2-4-6-7;;/h2*7H,1-6H2,(H,9,10);1H;/q;;;+3/p-3.
What are the key properties of [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate?
[bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate has a molecular weight of 432.01 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bromo(cycloheptanecarbonyloxy)gallanyl] cycloheptanecarboxylate is sourced from PubChem (CID 144651116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).