C15H18AlN3O5 — CID 144651587
[(1R)-2-(2-aminoanilino)-1-[(2R)-4-methylidenealumanyl-3-oxomorpholin-2-yl]-2-oxoethyl] acetate (PubChem CID 144651587) has the molecular formula C15H18AlN3O5 and a molecular weight of 347.31 g/mol. Its IUPAC name is [(1R)-2-(2-aminoanilino)-1-[(2R)-4-methylidenealumanyl-3-oxomorpholin-2-yl]-2-oxoethyl] acetate.
| Compound Name | [(1R)-2-(2-aminoanilino)-1-[(2R)-4-methylidenealumanyl-3-oxomorpholin-2-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 144651587 |
| Molecular Formula | C15H18AlN3O5 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [(1R)-2-(2-aminoanilino)-1-[(2R)-4-methylidenealumanyl-3-oxomorpholin-2-yl]-2-oxoethyl] acetate |
| SMILES | C=[Al]N1CCO[C@H]([C@@H](OC(C)=O)C(=O)Nc2ccccc2N)C1=O |
| InChI | InChI=1S/C14H17N3O5.CH2.Al/c1-8(18)22-12(11-13(19)16-6-7-21-11)14(20)17-10-5-3-2-4-9(10)15;;/h2-5,11-12H,6-7,15H2,1H3,(H2,16,17,19,20);1H2;/q;;+1/p-1/t11-,12-;;/m1../s1 |
| InChIKey | LIHIFMATTFASEO-MBORUXJMSA-M |
| XLogP | -0.58 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|