C19H34O4Si — CID 14465186
(6R,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 14465186) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is (6R,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (6R,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 14465186 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (6R,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(methoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | COCO[C@@H]1[C@H]2CC(=O)C(CO[Si](C)(C)C(C)(C)C)=C2CC1(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-18(2,3)24(7,8)23-11-15-14-10-19(4,5)17(22-12-21-6)13(14)9-16(15)20/h13,17H,9-12H2,1-8H3/t13-,17+/m0/s1 |
| InChIKey | MHFDBQFLSSQSSQ-SUMWQHHRSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|