C21H43N2+ — CID 144653526
1-[3-(3,4-diethylpyrrolidin-1-yl)propyl]-1,3,4-triethylpyrrolidin-1-ium (PubChem CID 144653526) has the molecular formula C21H43N2+ and a molecular weight of 323.59 g/mol. Its IUPAC name is 1-[3-(3,4-diethylpyrrolidin-1-yl)propyl]-1,3,4-triethylpyrrolidin-1-ium.
| Compound Name | 1-[3-(3,4-diethylpyrrolidin-1-yl)propyl]-1,3,4-triethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 144653526 |
| Molecular Formula | C21H43N2+ |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 323.34 |
| IUPAC Name | 1-[3-(3,4-diethylpyrrolidin-1-yl)propyl]-1,3,4-triethylpyrrolidin-1-ium |
| SMILES | CCC1CN(CCC[N+]2(CC)CC(CC)C(CC)C2)CC1CC |
| InChI | InChI=1S/C21H43N2/c1-6-18-14-22(15-19(18)7-2)12-11-13-23(10-5)16-20(8-3)21(9-4)17-23/h18-21H,6-17H2,1-5H3/q+1 |
| InChIKey | IVSKOYXBLKIRGW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|