About methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate
methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate (PubChem CID 144653698) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate.
Analyze methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate?
The IUPAC name of methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate (CID 144653698) is methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate is COC(=O)C1NC(C)(C)O[C@@H]1C.
What is the InChIKey of methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate?
The InChIKey is VWFRSFHGOANAFG-LWOQYNTDSA-N. The full InChI is InChI=1S/C8H15NO3/c1-5-6(7(10)11-4)9-8(2,3)12-5/h5-6,9H,1-4H3/t5-,6?/m1/s1.
What are the key properties of methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate?
methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate has a molecular weight of 173.21 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5R)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 144653698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).