C20H23FN4O3 — CID 144653790
ethane;3-[[5-fluoro-1-(oxolan-2-ylmethyl)indazol-3-yl]amino]pyridine-4-carboxylic acid (PubChem CID 144653790) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is ethane;3-[[5-fluoro-1-(oxolan-2-ylmethyl)indazol-3-yl]amino]pyridine-4-carboxylic acid.
| Compound Name | ethane;3-[[5-fluoro-1-(oxolan-2-ylmethyl)indazol-3-yl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 144653790 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethane;3-[[5-fluoro-1-(oxolan-2-ylmethyl)indazol-3-yl]amino]pyridine-4-carboxylic acid |
| SMILES | CC.O=C(O)c1ccncc1Nc1nn(CC2CCCO2)c2ccc(F)cc12 |
| InChI | InChI=1S/C18H17FN4O3.C2H6/c19-11-3-4-16-14(8-11)17(22-23(16)10-12-2-1-7-26-12)21-15-9-20-6-5-13(15)18(24)25;1-2/h3-6,8-9,12H,1-2,7,10H2,(H,21,22)(H,24,25);1-2H3 |
| InChIKey | QDVUUMLNBCGAAX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |