C20H23FN4O3 — CID 144653813
3-[[1-(2-ethyl-4-methoxybutyl)-5-fluoroindazol-3-yl]amino]pyridine-4-carboxylic acid (PubChem CID 144653813) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-[[1-(2-ethyl-4-methoxybutyl)-5-fluoroindazol-3-yl]amino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[1-(2-ethyl-4-methoxybutyl)-5-fluoroindazol-3-yl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 144653813 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-[[1-(2-ethyl-4-methoxybutyl)-5-fluoroindazol-3-yl]amino]pyridine-4-carboxylic acid |
| SMILES | CCC(CCOC)Cn1nc(Nc2cnccc2C(=O)O)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H23FN4O3/c1-3-13(7-9-28-2)12-25-18-5-4-14(21)10-16(18)19(24-25)23-17-11-22-8-6-15(17)20(26)27/h4-6,8,10-11,13H,3,7,9,12H2,1-2H3,(H,23,24)(H,26,27) |
| InChIKey | BYIIQBYSAIKUHM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |