C13H24N2 — CID 144655866
N-buta-1,3-dien-2-yl-1-(2-methylpropyl)piperidin-4-amine (PubChem CID 144655866) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-1-(2-methylpropyl)piperidin-4-amine.
| Compound Name | N-buta-1,3-dien-2-yl-1-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 144655866 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-buta-1,3-dien-2-yl-1-(2-methylpropyl)piperidin-4-amine |
| SMILES | C=CC(=C)NC1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-5-12(4)14-13-6-8-15(9-7-13)10-11(2)3/h5,11,13-14H,1,4,6-10H2,2-3H3 |
| InChIKey | BVNBAVDKHKVINY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|