C17H22N2O3 — CID 144656440
3-[(4-ethyl-3-methoxyphenyl)methylamino]pyridine-4-carbaldehyde;methanol (PubChem CID 144656440) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[(4-ethyl-3-methoxyphenyl)methylamino]pyridine-4-carbaldehyde;methanol.
| Compound Name | 3-[(4-ethyl-3-methoxyphenyl)methylamino]pyridine-4-carbaldehyde;methanol |
|---|---|
| PubChem CID | 144656440 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[(4-ethyl-3-methoxyphenyl)methylamino]pyridine-4-carbaldehyde;methanol |
| SMILES | CCc1ccc(CNc2cnccc2C=O)cc1OC.CO |
| InChI | InChI=1S/C16H18N2O2.CH4O/c1-3-13-5-4-12(8-16(13)20-2)9-18-15-10-17-7-6-14(15)11-19;1-2/h4-8,10-11,18H,3,9H2,1-2H3;2H,1H3 |
| InChIKey | OGJHTEPYTJQPMY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|