C22H30N2O3 — CID 144656504
3-[[(4S)-7-cyclopropyl-3,4-dihydro-2H-chromen-4-yl]methylamino]pyridine-4-carbaldehyde;ethane;methanol (PubChem CID 144656504) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-[[(4S)-7-cyclopropyl-3,4-dihydro-2H-chromen-4-yl]methylamino]pyridine-4-carbaldehyde;ethane;methanol.
| Compound Name | 3-[[(4S)-7-cyclopropyl-3,4-dihydro-2H-chromen-4-yl]methylamino]pyridine-4-carbaldehyde;ethane;methanol |
|---|---|
| PubChem CID | 144656504 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-[[(4S)-7-cyclopropyl-3,4-dihydro-2H-chromen-4-yl]methylamino]pyridine-4-carbaldehyde;ethane;methanol |
| SMILES | CC.CO.O=Cc1ccncc1NC[C@H]1CCOc2cc(C3CC3)ccc21 |
| InChI | InChI=1S/C19H20N2O2.C2H6.CH4O/c22-12-16-5-7-20-11-18(16)21-10-15-6-8-23-19-9-14(13-1-2-13)3-4-17(15)19;2*1-2/h3-5,7,9,11-13,15,21H,1-2,6,8,10H2;1-2H3;2H,1H3/t15-;;/m1../s1 |
| InChIKey | OJKNBCJTNLFPAW-QCUBGVIVSA-N |
| XLogP | 4.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|