C11H15F2N3 — CID 144656704
(3R)-1-(3,5-difluoro-2-pyridinyl)-3-ethylpiperazine (PubChem CID 144656704) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3R)-1-(3,5-difluoro-2-pyridinyl)-3-ethylpiperazine.
| Compound Name | (3R)-1-(3,5-difluoro-2-pyridinyl)-3-ethylpiperazine |
|---|---|
| PubChem CID | 144656704 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3R)-1-(3,5-difluoro-2-pyridinyl)-3-ethylpiperazine |
| SMILES | CC[C@@H]1CN(c2ncc(F)cc2F)CCN1 |
| InChI | InChI=1S/C11H15F2N3/c1-2-9-7-16(4-3-14-9)11-10(13)5-8(12)6-15-11/h5-6,9,14H,2-4,7H2,1H3/t9-/m1/s1 |
| InChIKey | CCXAITWZWPFBDH-SECBINFHSA-N |
| XLogP | 1.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |