C19H20N4O4 — CID 144657224
N-(2-acetyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-methyl-5-nitrobenzamide;ethane (PubChem CID 144657224) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(2-acetyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-methyl-5-nitrobenzamide;ethane.
| Compound Name | N-(2-acetyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-methyl-5-nitrobenzamide;ethane |
|---|---|
| PubChem CID | 144657224 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(2-acetyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-methyl-5-nitrobenzamide;ethane |
| SMILES | CC.CC(=O)c1cc2cc(NC(=O)c3cc([N+](=O)[O-])ccc3C)cnc2[nH]1 |
| InChI | InChI=1S/C17H14N4O4.C2H6/c1-9-3-4-13(21(24)25)7-14(9)17(23)19-12-5-11-6-15(10(2)22)20-16(11)18-8-12;1-2/h3-8H,1-2H3,(H,18,20)(H,19,23);1-2H3 |
| InChIKey | SKTQFBRGMODKDT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|