C39H33N5 — CID 144660236
(E)-2-[2-[4,6-di(phenanthren-9-yl)-1,3,5-triazinan-2-yl]-2H-pyrrol-5-yl]but-2-en-1-imine (PubChem CID 144660236) has the molecular formula C39H33N5 and a molecular weight of 571.73 g/mol. Its IUPAC name is (E)-2-[2-[4,6-di(phenanthren-9-yl)-1,3,5-triazinan-2-yl]-2H-pyrrol-5-yl]but-2-en-1-imine.
| Compound Name | (E)-2-[2-[4,6-di(phenanthren-9-yl)-1,3,5-triazinan-2-yl]-2H-pyrrol-5-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144660236 |
| Molecular Formula | C39H33N5 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (E)-2-[2-[4,6-di(phenanthren-9-yl)-1,3,5-triazinan-2-yl]-2H-pyrrol-5-yl]but-2-en-1-imine |
| SMILES | [H]/N=C/C(=C\C)C1=NC(C2NC(c3cc4ccccc4c4ccccc34)NC(c3cc4ccccc4c4ccccc34)N2)C=C1 |
| InChI | InChI=1S/C39H33N5/c1-2-24(23-40)35-19-20-36(41-35)39-43-37(33-21-25-11-3-5-13-27(25)29-15-7-9-17-31(29)33)42-38(44-39)34-22-26-12-4-6-14-28(26)30-16-8-10-18-32(30)34/h2-23,36-40,42-44H,1H3/b24-2+,40-23+ |
| InChIKey | AXPUCHFUBXVGGV-DQFUWHNUSA-N |
| XLogP | 8.08 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|