C31H32N5+ — CID 144660257
[[[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]amino]-naphthalen-2-ylmethyl]azanium (PubChem CID 144660257) has the molecular formula C31H32N5+ and a molecular weight of 474.63 g/mol. Its IUPAC name is [[[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]amino]-naphthalen-2-ylmethyl]azanium.
| Compound Name | [[[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]amino]-naphthalen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 144660257 |
| Molecular Formula | C31H32N5+ |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | [[[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]amino]-naphthalen-2-ylmethyl]azanium |
| SMILES | [H]/N=C/C(=C\C)C1C=CC(CNC(NC([NH3+])c2ccc3ccccc3c2)c2ccc3ccccc3c2)=N1 |
| InChI | InChI=1S/C31H31N5/c1-2-21(19-32)29-16-15-28(35-29)20-34-31(27-14-12-23-8-4-6-10-25(23)18-27)36-30(33)26-13-11-22-7-3-5-9-24(22)17-26/h2-19,29-32,34,36H,20,33H2,1H3/p+1/b21-2+,32-19+ |
| InChIKey | ASVQEQGKCNCUAM-WAYONBHZSA-O |
| XLogP | 5.09 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|