C31H31N5 — CID 144660258
N'-[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]-1-naphthalen-2-ylmethanediamine (PubChem CID 144660258) has the molecular formula C31H31N5 and a molecular weight of 473.62 g/mol. Its IUPAC name is N'-[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]-1-naphthalen-2-ylmethanediamine.
| Compound Name | N'-[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]-1-naphthalen-2-ylmethanediamine |
|---|---|
| PubChem CID | 144660258 |
| Molecular Formula | C31H31N5 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | N'-[[[2-[(Z)-1-iminobut-2-en-2-yl]-2H-pyrrol-5-yl]methylamino]-naphthalen-2-ylmethyl]-1-naphthalen-2-ylmethanediamine |
| SMILES | [H]/N=C/C(=C\C)C1C=CC(CNC(NC(N)c2ccc3ccccc3c2)c2ccc3ccccc3c2)=N1 |
| InChI | InChI=1S/C31H31N5/c1-2-21(19-32)29-16-15-28(35-29)20-34-31(27-14-12-23-8-4-6-10-25(23)18-27)36-30(33)26-13-11-22-7-3-5-9-24(22)17-26/h2-19,29-32,34,36H,20,33H2,1H3/b21-2+,32-19+ |
| InChIKey | ASVQEQGKCNCUAM-WAYONBHZSA-N |
| XLogP | 5.80 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|