C21H18 — CID 144660686
10,19-dimethyltetracyclo[12.4.1.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene (PubChem CID 144660686) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is 10,19-dimethyltetracyclo[12.4.1.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene.
| Compound Name | 10,19-dimethyltetracyclo[12.4.1.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene |
|---|---|
| PubChem CID | 144660686 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 10,19-dimethyltetracyclo[12.4.1.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene |
| SMILES | CC1=C2C=CC=CC1c1ccc(C)cc1-c1ccccc12 |
| InChI | InChI=1S/C21H18/c1-14-11-12-20-17-8-4-3-7-16(15(17)2)18-9-5-6-10-19(18)21(20)13-14/h3-13,17H,1-2H3 |
| InChIKey | MXHXFQNBXKEPNH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |