C19H16 — CID 22620643
9-cyclopenta-1,3-dien-1-yl-3-methyl-9H-fluorene (PubChem CID 22620643) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is 9-cyclopenta-1,3-dien-1-yl-3-methyl-9H-fluorene.
| Compound Name | 9-cyclopenta-1,3-dien-1-yl-3-methyl-9H-fluorene |
|---|---|
| PubChem CID | 22620643 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 9-cyclopenta-1,3-dien-1-yl-3-methyl-9H-fluorene |
| SMILES | Cc1ccc2c(c1)-c1ccccc1C2C1=CC=CC1 |
| InChI | InChI=1S/C19H16/c1-13-10-11-17-18(12-13)15-8-4-5-9-16(15)19(17)14-6-2-3-7-14/h2-6,8-12,19H,7H2,1H3 |
| InChIKey | PSGHVLPSSMIAAO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |