C21H19Cl3Zr — CID 173293137
9-cyclopenta-1,3-dien-1-yl-2-propan-2-yl-1,9-dihydrofluoren-1-ide;zirconium(4+);trichloride (PubChem CID 173293137) has the molecular formula C21H19Cl3Zr and a molecular weight of 468.97 g/mol. Its IUPAC name is 9-cyclopenta-1,3-dien-1-yl-2-propan-2-yl-1,9-dihydrofluoren-1-ide;zirconium(4+);trichloride.
| Compound Name | 9-cyclopenta-1,3-dien-1-yl-2-propan-2-yl-1,9-dihydrofluoren-1-ide;zirconium(4+);trichloride |
|---|---|
| PubChem CID | 173293137 |
| Molecular Formula | C21H19Cl3Zr |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | 9-cyclopenta-1,3-dien-1-yl-2-propan-2-yl-1,9-dihydrofluoren-1-ide;zirconium(4+);trichloride |
| SMILES | CC(C)c1[c-]c2c(cc1)-c1ccccc1C2C1=CC=CC1.[Cl-].[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/C21H19.3ClH.Zr/c1-14(2)16-11-12-18-17-9-5-6-10-19(17)21(20(18)13-16)15-7-3-4-8-15;;;;/h3-7,9-12,14,21H,8H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | BBILPQHOSCNCRT-UHFFFAOYSA-K |
| XLogP | -3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|