About fluoro formate;9-methoxy-3-methyl-9H-fluorene
fluoro formate;9-methoxy-3-methyl-9H-fluorene (PubChem CID 169197924) has the molecular formula C16H15FO3
and a molecular weight of 274.29 g/mol. Its IUPAC name is fluoro formate;9-methoxy-3-methyl-9H-fluorene.
Molecular Properties
| Compound Name | fluoro formate;9-methoxy-3-methyl-9H-fluorene |
| PubChem CID | 169197924 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | fluoro formate;9-methoxy-3-methyl-9H-fluorene |
| SMILES | COC1c2ccccc2-c2cc(C)ccc21.O=COF |
| InChI | InChI=1S/C15H14O.CHFO2/c1-10-7-8-13-14(9-10)11-5-3-4-6-12(11)15(13)16-2;2-4-1-3/h3-9,15H,1-2H3;1H |
| InChIKey | VLCHGRVNFGBXFS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluoro formate;9-methoxy-3-methyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro formate;9-methoxy-3-methyl-9H-fluorene?
The IUPAC name of fluoro formate;9-methoxy-3-methyl-9H-fluorene (CID 169197924) is fluoro formate;9-methoxy-3-methyl-9H-fluorene.
What is the SMILES notation for fluoro formate;9-methoxy-3-methyl-9H-fluorene?
The canonical SMILES for fluoro formate;9-methoxy-3-methyl-9H-fluorene is COC1c2ccccc2-c2cc(C)ccc21.O=COF.
What is the InChIKey of fluoro formate;9-methoxy-3-methyl-9H-fluorene?
The InChIKey is VLCHGRVNFGBXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.CHFO2/c1-10-7-8-13-14(9-10)11-5-3-4-6-12(11)15(13)16-2;2-4-1-3/h3-9,15H,1-2H3;1H.
What are the key properties of fluoro formate;9-methoxy-3-methyl-9H-fluorene?
fluoro formate;9-methoxy-3-methyl-9H-fluorene has a molecular weight of 274.29 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro formate;9-methoxy-3-methyl-9H-fluorene is sourced from PubChem (CID 169197924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).