C16H13ClO — CID 10912160
9-chloro-10-methoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaene (PubChem CID 10912160) has the molecular formula C16H13ClO and a molecular weight of 256.73 g/mol. Its IUPAC name is 9-chloro-10-methoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaene.
| Compound Name | 9-chloro-10-methoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaene |
|---|---|
| PubChem CID | 10912160 |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 9-chloro-10-methoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaene |
| SMILES | COC1C(Cl)=Cc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C16H13ClO/c1-18-16-14-9-5-4-8-13(14)12-7-3-2-6-11(12)10-15(16)17/h2-10,16H,1H3 |
| InChIKey | JLWORYOZUPJOJI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |