C10H17N3 — CID 144662023
(Z)-N-[(2E)-1-aminopenta-2,4-dien-2-yl]-N-methylbut-2-enimidamide (PubChem CID 144662023) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (Z)-N-[(2E)-1-aminopenta-2,4-dien-2-yl]-N-methylbut-2-enimidamide.
| Compound Name | (Z)-N-[(2E)-1-aminopenta-2,4-dien-2-yl]-N-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 144662023 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (Z)-N-[(2E)-1-aminopenta-2,4-dien-2-yl]-N-methylbut-2-enimidamide |
| SMILES | [H]/N=C(\C=C/C)N(C)/C(=C/C=C)CN |
| InChI | InChI=1S/C10H17N3/c1-4-6-9(8-11)13(3)10(12)7-5-2/h4-7,12H,1,8,11H2,2-3H3/b7-5-,9-6+,12-10+ |
| InChIKey | PDMBSBFAOGPKQR-BKHONKLNSA-N |
| XLogP | 1.50 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|