About 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine
3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine (PubChem CID 144662822) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine.
Molecular Properties
| Compound Name | 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine |
| PubChem CID | 144662822 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine |
| SMILES | CC(c1ccccc1)C(C)(C)C.CCCC1(N)CC1 |
| InChI | InChI=1S/C12H18.C6H13N/c1-10(12(2,3)4)11-8-6-5-7-9-11;1-2-3-6(7)4-5-6/h5-10H,1-4H3;2-5,7H2,1H3 |
| InChIKey | QTPHTFSLEBRMOV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine?
The IUPAC name of 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine (CID 144662822) is 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine.
What is the SMILES notation for 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine?
The canonical SMILES for 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine is CC(c1ccccc1)C(C)(C)C.CCCC1(N)CC1.
What is the InChIKey of 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine?
The InChIKey is QTPHTFSLEBRMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C6H13N/c1-10(12(2,3)4)11-8-6-5-7-9-11;1-2-3-6(7)4-5-6/h5-10H,1-4H3;2-5,7H2,1H3.
What are the key properties of 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine?
3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine has a molecular weight of 261.45 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-ylbenzene;1-propylcyclopropan-1-amine is sourced from PubChem (CID 144662822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).