C17H20N2 — CID 144664765
4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen (PubChem CID 144664765) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen.
| Compound Name | 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144664765 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1ccc(-c2cn[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2.C2H6.H2/c1-3-7-12(8-4-1)14-11-16-17-15(14)13-9-5-2-6-10-13;1-2;/h1-11H,(H,16,17);1-2H3;1H |
| InChIKey | DXCQIRWBIAYPIS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |