4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen

C17H20N2 — CID 144664765

IUPAC4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen
SMILESCC.[H][H].c1ccc(-c2cn[nH]c2-c2ccccc2)cc1
InChIInChI=1S/C15H12N2.C2H6.H2/c1-3-7-12(8-4-1)14-11-16-17-15(14)13-9-5-2-6-10-13;1-2;/h1-11H,(H,16,17);1-2H3;1H
InChIKeyDXCQIRWBIAYPIS-UHFFFAOYSA-N
MW252.36 g/mol
LogP5.02
Rot. Bonds2

About 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen

4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen (PubChem CID 144664765) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen.

Molecular Properties

Compound Name4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen
PubChem CID144664765
Molecular FormulaC17H20N2
Molecular Weight252.36 g/mol
Exact Mass252.16
IUPAC Name4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen
SMILESCC.[H][H].c1ccc(-c2cn[nH]c2-c2ccccc2)cc1
InChIInChI=1S/C15H12N2.C2H6.H2/c1-3-7-12(8-4-1)14-11-16-17-15(14)13-9-5-2-6-10-13;1-2;/h1-11H,(H,16,17);1-2H3;1H
InChIKeyDXCQIRWBIAYPIS-UHFFFAOYSA-N
XLogP5.02
TPSA28.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500252.36
LogP ≤ 55.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen?
The IUPAC name of 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen (CID 144664765) is 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen.
What is the SMILES notation for 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen?
The canonical SMILES for 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen is CC.[H][H].c1ccc(-c2cn[nH]c2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen?
The InChIKey is DXCQIRWBIAYPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2.C2H6.H2/c1-3-7-12(8-4-1)14-11-16-17-15(14)13-9-5-2-6-10-13;1-2;/h1-11H,(H,16,17);1-2H3;1H.
What are the key properties of 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen?
4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen has a molecular weight of 252.36 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-1H-pyrazole;ethane;molecular hydrogen is sourced from PubChem (CID 144664765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).