C10H13N2O4P — CID 154878944
5-methyl-4-phenyl-1H-pyrazole;phosphoric acid (PubChem CID 154878944) has the molecular formula C10H13N2O4P and a molecular weight of 256.20 g/mol. Its IUPAC name is 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid.
| Compound Name | 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid |
|---|---|
| PubChem CID | 154878944 |
| Molecular Formula | C10H13N2O4P |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid |
| SMILES | Cc1[nH]ncc1-c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C10H10N2.H3O4P/c1-8-10(7-11-12-8)9-5-3-2-4-6-9;1-5(2,3)4/h2-7H,1H3,(H,11,12);(H3,1,2,3,4) |
| InChIKey | VWQMYGFYEYUVIR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|