5-methyl-4-phenyl-1H-pyrazole;phosphoric acid

C10H13N2O4P — CID 154878944

IUPAC5-methyl-4-phenyl-1H-pyrazole;phosphoric acid
SMILESCc1[nH]ncc1-c1ccccc1.O=P(O)(O)O
InChIInChI=1S/C10H10N2.H3O4P/c1-8-10(7-11-12-8)9-5-3-2-4-6-9;1-5(2,3)4/h2-7H,1H3,(H,11,12);(H3,1,2,3,4)
InChIKeyVWQMYGFYEYUVIR-UHFFFAOYSA-N
MW256.20 g/mol
LogP1.46
Rot. Bonds1

About 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid

5-methyl-4-phenyl-1H-pyrazole;phosphoric acid (PubChem CID 154878944) has the molecular formula C10H13N2O4P and a molecular weight of 256.20 g/mol. Its IUPAC name is 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid.

Molecular Properties

Compound Name5-methyl-4-phenyl-1H-pyrazole;phosphoric acid
PubChem CID154878944
Molecular FormulaC10H13N2O4P
Molecular Weight256.20 g/mol
Exact Mass256.06
IUPAC Name5-methyl-4-phenyl-1H-pyrazole;phosphoric acid
SMILESCc1[nH]ncc1-c1ccccc1.O=P(O)(O)O
InChIInChI=1S/C10H10N2.H3O4P/c1-8-10(7-11-12-8)9-5-3-2-4-6-9;1-5(2,3)4/h2-7H,1H3,(H,11,12);(H3,1,2,3,4)
InChIKeyVWQMYGFYEYUVIR-UHFFFAOYSA-N
XLogP1.46
TPSA106.44 Ų
H-Bond Donors4
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.20
LogP ≤ 51.46
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid?
The IUPAC name of 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid (CID 154878944) is 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid.
What is the SMILES notation for 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid?
The canonical SMILES for 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid is Cc1[nH]ncc1-c1ccccc1.O=P(O)(O)O.
What is the InChIKey of 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid?
The InChIKey is VWQMYGFYEYUVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.H3O4P/c1-8-10(7-11-12-8)9-5-3-2-4-6-9;1-5(2,3)4/h2-7H,1H3,(H,11,12);(H3,1,2,3,4).
What are the key properties of 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid?
5-methyl-4-phenyl-1H-pyrazole;phosphoric acid has a molecular weight of 256.20 g/mol, XLogP of 1.46, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-phenyl-1H-pyrazole;phosphoric acid is sourced from PubChem (CID 154878944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).