C15H27NS — CID 144667383
5,6-dimethyl-N-(3-methyl-1-methylsulfanylbut-3-en-2-yl)hepta-1,6-dien-2-amine (PubChem CID 144667383) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 5,6-dimethyl-N-(3-methyl-1-methylsulfanylbut-3-en-2-yl)hepta-1,6-dien-2-amine.
| Compound Name | 5,6-dimethyl-N-(3-methyl-1-methylsulfanylbut-3-en-2-yl)hepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 144667383 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5,6-dimethyl-N-(3-methyl-1-methylsulfanylbut-3-en-2-yl)hepta-1,6-dien-2-amine |
| SMILES | C=C(CCC(C)C(=C)C)NC(CSC)C(=C)C |
| InChI | InChI=1S/C15H27NS/c1-11(2)13(5)8-9-14(6)16-15(10-17-7)12(3)4/h13,15-16H,1,3,6,8-10H2,2,4-5,7H3 |
| InChIKey | AUSJSCBWZWLIRN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|