C11H21NS — CID 57027759
2-methyl-N,2-dipropyl-3H-thiophen-3-amine (PubChem CID 57027759) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 2-methyl-N,2-dipropyl-3H-thiophen-3-amine.
| Compound Name | 2-methyl-N,2-dipropyl-3H-thiophen-3-amine |
|---|---|
| PubChem CID | 57027759 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-methyl-N,2-dipropyl-3H-thiophen-3-amine |
| SMILES | CCCNC1C=CSC1(C)CCC |
| InChI | InChI=1S/C11H21NS/c1-4-7-11(3)10(6-9-13-11)12-8-5-2/h6,9-10,12H,4-5,7-8H2,1-3H3 |
| InChIKey | FGMLSKADABUDMH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |