C10H19NS — CID 54478450
N,2-dipropyl-2,3-dihydrothiophen-3-amine (PubChem CID 54478450) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is N,2-dipropyl-2,3-dihydrothiophen-3-amine.
| Compound Name | N,2-dipropyl-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 54478450 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N,2-dipropyl-2,3-dihydrothiophen-3-amine |
| SMILES | CCCNC1C=CSC1CCC |
| InChI | InChI=1S/C10H19NS/c1-3-5-10-9(6-8-12-10)11-7-4-2/h6,8-11H,3-5,7H2,1-2H3 |
| InChIKey | XNGSLOBPSKNOCN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |