C7H13NS — CID 57119299
2-propyl-2,3-dihydrothiophen-3-amine (PubChem CID 57119299) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 2-propyl-2,3-dihydrothiophen-3-amine.
| Compound Name | 2-propyl-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 57119299 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2-propyl-2,3-dihydrothiophen-3-amine |
| SMILES | CCCC1SC=CC1N |
| InChI | InChI=1S/C7H13NS/c1-2-3-7-6(8)4-5-9-7/h4-7H,2-3,8H2,1H3 |
| InChIKey | KLUCUNZBFCYSBC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |