C21H35N3 — CID 144667464
(5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methanamine;1-pyridin-3-ylethenamine (PubChem CID 144667464) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is (5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methanamine;1-pyridin-3-ylethenamine.
| Compound Name | (5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methanamine;1-pyridin-3-ylethenamine |
|---|---|
| PubChem CID | 144667464 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | (5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methanamine;1-pyridin-3-ylethenamine |
| SMILES | C=C(N)c1cccnc1.CC1(C)CCCC2(C)C(CN)CCCC12 |
| InChI | InChI=1S/C14H27N.C7H8N2/c1-13(2)8-5-9-14(3)11(10-15)6-4-7-12(13)14;1-6(8)7-3-2-4-9-5-7/h11-12H,4-10,15H2,1-3H3;2-5H,1,8H2 |
| InChIKey | JZWYBOXTWKVBBZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |