C22H34N2O4S — CID 90290027
[(1S,2S,3R,8aS)-2,5,5,8a-tetramethyl-3-(pyridine-3-carbonylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl methanesulfonate (PubChem CID 90290027) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is [(1S,2S,3R,8aS)-2,5,5,8a-tetramethyl-3-(pyridine-3-carbonylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl methanesulfonate.
| Compound Name | [(1S,2S,3R,8aS)-2,5,5,8a-tetramethyl-3-(pyridine-3-carbonylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90290027 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(1S,2S,3R,8aS)-2,5,5,8a-tetramethyl-3-(pyridine-3-carbonylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl methanesulfonate |
| SMILES | C[C@@H]1[C@H](NC(=O)c2cccnc2)CC2C(C)(C)CCC[C@]2(C)[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C22H34N2O4S/c1-15-17(14-28-29(5,26)27)22(4)10-7-9-21(2,3)19(22)12-18(15)24-20(25)16-8-6-11-23-13-16/h6,8,11,13,15,17-19H,7,9-10,12,14H2,1-5H3,(H,24,25)/t15-,17-,18+,19?,22+/m0/s1 |
| InChIKey | HGHMUYGWTSWAKJ-FOEYLUNMSA-N |
| XLogP | 3.64 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|