C12H19N3 — CID 144668209
3,5-dimethyl-4-phenyl-1,5-dihydro-1,2,4-triazole;ethane (PubChem CID 144668209) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenyl-1,5-dihydro-1,2,4-triazole;ethane.
| Compound Name | 3,5-dimethyl-4-phenyl-1,5-dihydro-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 144668209 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3,5-dimethyl-4-phenyl-1,5-dihydro-1,2,4-triazole;ethane |
| SMILES | CC.CC1=NNC(C)N1c1ccccc1 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-8-11-12-9(2)13(8)10-6-4-3-5-7-10;1-2/h3-8,11H,1-2H3;1-2H3 |
| InChIKey | ZXZBENZDXPSHJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |