C9H16O3 — CID 14466823
2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol (PubChem CID 14466823) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol.
| Compound Name | 2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol |
|---|---|
| PubChem CID | 14466823 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol |
| SMILES | OCCC1=C(CO)C(CO)CC1 |
| InChI | InChI=1S/C9H16O3/c10-4-3-7-1-2-8(5-11)9(7)6-12/h8,10-12H,1-6H2 |
| InChIKey | SNRXLUZYBRTVHL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|