C20H34N4O — CID 144669385
(2R)-3-cyclohexyl-N-[(3-ethanehydrazonoylphenyl)methyl]-2-methylpropanamide;methanamine (PubChem CID 144669385) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-N-[(3-ethanehydrazonoylphenyl)methyl]-2-methylpropanamide;methanamine.
| Compound Name | (2R)-3-cyclohexyl-N-[(3-ethanehydrazonoylphenyl)methyl]-2-methylpropanamide;methanamine |
|---|---|
| PubChem CID | 144669385 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (2R)-3-cyclohexyl-N-[(3-ethanehydrazonoylphenyl)methyl]-2-methylpropanamide;methanamine |
| SMILES | C/C(=N\N)c1cccc(CNC(=O)[C@H](C)CC2CCCCC2)c1.CN |
| InChI | InChI=1S/C19H29N3O.CH5N/c1-14(11-16-7-4-3-5-8-16)19(23)21-13-17-9-6-10-18(12-17)15(2)22-20;1-2/h6,9-10,12,14,16H,3-5,7-8,11,13,20H2,1-2H3,(H,21,23);2H2,1H3/b22-15+;/t14-;/m1./s1 |
| InChIKey | MNSLYYUUGDIRAQ-ICYSGURNSA-N |
| XLogP | 3.17 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|